C22H33N5O2 — CID 55770196
1-[3-(cyclohexylamino)propyl]-3-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea (PubChem CID 55770196) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-[3-(cyclohexylamino)propyl]-3-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea.
| Compound Name | 1-[3-(cyclohexylamino)propyl]-3-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 55770196 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 1-[3-(cyclohexylamino)propyl]-3-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea |
| SMILES | COc1cccc(C(NC(=O)NCCCNC2CCCCC2)c2nccn2C)c1 |
| InChI | InChI=1S/C22H33N5O2/c1-27-15-14-24-21(27)20(17-8-6-11-19(16-17)29-2)26-22(28)25-13-7-12-23-18-9-4-3-5-10-18/h6,8,11,14-16,18,20,23H,3-5,7,9-10,12-13H2,1-2H3,(H2,25,26,28) |
| InChIKey | MEGUYVWEAOSCJQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|