C20H20N4O6S — CID 55457881
N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-methylsulfonyl-3-nitrobenzamide (PubChem CID 55457881) has the molecular formula C20H20N4O6S and a molecular weight of 444.47 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-methylsulfonyl-3-nitrobenzamide.
| Compound Name | N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-methylsulfonyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 55457881 |
| Molecular Formula | C20H20N4O6S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-methylsulfonyl-3-nitrobenzamide |
| SMILES | COc1ccc(C(NC(=O)c2ccc(S(C)(=O)=O)c([N+](=O)[O-])c2)c2nccn2C)cc1 |
| InChI | InChI=1S/C20H20N4O6S/c1-23-11-10-21-19(23)18(13-4-7-15(30-2)8-5-13)22-20(25)14-6-9-17(31(3,28)29)16(12-14)24(26)27/h4-12,18H,1-3H3,(H,22,25) |
| InChIKey | OWLVTBPOBTYAQR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|