C21H24N6O6S — CID 24625824
N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(2-nitro-4-sulfamoylanilino)propanamide (PubChem CID 24625824) has the molecular formula C21H24N6O6S and a molecular weight of 488.53 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(2-nitro-4-sulfamoylanilino)propanamide.
| Compound Name | N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(2-nitro-4-sulfamoylanilino)propanamide |
|---|---|
| PubChem CID | 24625824 |
| Molecular Formula | C21H24N6O6S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(2-nitro-4-sulfamoylanilino)propanamide |
| SMILES | COc1ccc(C(NC(=O)CCNc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])c2nccn2C)cc1 |
| InChI | InChI=1S/C21H24N6O6S/c1-26-12-11-24-21(26)20(14-3-5-15(33-2)6-4-14)25-19(28)9-10-23-17-8-7-16(34(22,31)32)13-18(17)27(29)30/h3-8,11-13,20,23H,9-10H2,1-2H3,(H,25,28)(H2,22,31,32) |
| InChIKey | FYJVTMUVGTWNDN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 171.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|