C25H22N4O4 — CID 134032227
[4-[[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrophenyl]-phenylmethanone (PubChem CID 134032227) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is [4-[[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrophenyl]-phenylmethanone.
| Compound Name | [4-[[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 134032227 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [4-[[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrophenyl]-phenylmethanone |
| SMILES | COc1ccc(C(Nc2ccc(C(=O)c3ccccc3)cc2[N+](=O)[O-])c2nccn2C)cc1 |
| InChI | InChI=1S/C25H22N4O4/c1-28-15-14-26-25(28)23(17-8-11-20(33-2)12-9-17)27-21-13-10-19(16-22(21)29(31)32)24(30)18-6-4-3-5-7-18/h3-16,23,27H,1-2H3 |
| InChIKey | GKLAZWRZELHZOA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|