C22H25N5O6S — CID 24541735
N-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline (PubChem CID 24541735) has the molecular formula C22H25N5O6S and a molecular weight of 487.54 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline.
| Compound Name | N-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 24541735 |
| Molecular Formula | C22H25N5O6S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| SMILES | COc1cccc(C(Nc2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])c2nccn2C)c1 |
| InChI | InChI=1S/C22H25N5O6S/c1-25-9-8-23-22(25)21(16-4-3-5-17(14-16)32-2)24-19-7-6-18(15-20(19)27(28)29)34(30,31)26-10-12-33-13-11-26/h3-9,14-15,21,24H,10-13H2,1-2H3 |
| InChIKey | FCKIFCOKCVHVBF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 128.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|