C22H27N5O5S — CID 24541736
N,N-diethyl-4-[[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrobenzenesulfonamide (PubChem CID 24541736) has the molecular formula C22H27N5O5S and a molecular weight of 473.56 g/mol. Its IUPAC name is N,N-diethyl-4-[[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24541736 |
| Molecular Formula | C22H27N5O5S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | N,N-diethyl-4-[[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(c2cccc(OC)c2)c2nccn2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H27N5O5S/c1-5-26(6-2)33(30,31)18-10-11-19(20(15-18)27(28)29)24-21(22-23-12-13-25(22)3)16-8-7-9-17(14-16)32-4/h7-15,21,24H,5-6H2,1-4H3 |
| InChIKey | VRNUIYTZDVSCFW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|