C18H18FN5O4S — CID 25390637
4-[[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 25390637) has the molecular formula C18H18FN5O4S and a molecular weight of 419.44 g/mol. Its IUPAC name is 4-[[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 25390637 |
| Molecular Formula | C18H18FN5O4S |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-[[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N[C@H](c2ccccc2F)c2nccn2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18FN5O4S/c1-20-29(27,28)12-7-8-15(16(11-12)24(25)26)22-17(18-21-9-10-23(18)2)13-5-3-4-6-14(13)19/h3-11,17,20,22H,1-2H3/t17-/m1/s1 |
| InChIKey | ZKQXMRWLXMBACQ-QGZVFWFLSA-N |
| XLogP | 2.58 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|