C17H15ClFN3O2S — CID 18109066
4-chloro-N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide (PubChem CID 18109066) has the molecular formula C17H15ClFN3O2S and a molecular weight of 379.84 g/mol. Its IUPAC name is 4-chloro-N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18109066 |
| Molecular Formula | C17H15ClFN3O2S |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 4-chloro-N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
| SMILES | Cn1ccnc1C(NS(=O)(=O)c1ccc(Cl)cc1)c1ccccc1F |
| InChI | InChI=1S/C17H15ClFN3O2S/c1-22-11-10-20-17(22)16(14-4-2-3-5-15(14)19)21-25(23,24)13-8-6-12(18)7-9-13/h2-11,16,21H,1H3 |
| InChIKey | JVTFOCXILMALBP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |