C17H15F2N3O2S — CID 25350052
4-fluoro-N-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide (PubChem CID 25350052) has the molecular formula C17H15F2N3O2S and a molecular weight of 363.39 g/mol. Its IUPAC name is 4-fluoro-N-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25350052 |
| Molecular Formula | C17H15F2N3O2S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-fluoro-N-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
| SMILES | Cn1ccnc1[C@@H](NS(=O)(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15F2N3O2S/c1-22-11-10-20-17(22)16(12-2-4-13(18)5-3-12)21-25(23,24)15-8-6-14(19)7-9-15/h2-11,16,21H,1H3/t16-/m0/s1 |
| InChIKey | TUXOBVNWRFCWSD-INIZCTEOSA-N |
| XLogP | 2.77 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |