C23H26FN3O2S — CID 24541144
4-cyclohexyl-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide (PubChem CID 24541144) has the molecular formula C23H26FN3O2S and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-cyclohexyl-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-cyclohexyl-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24541144 |
| Molecular Formula | C23H26FN3O2S |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-cyclohexyl-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
| SMILES | Cn1ccnc1C(NS(=O)(=O)c1ccc(C2CCCCC2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN3O2S/c1-27-16-15-25-23(27)22(19-7-11-20(24)12-8-19)26-30(28,29)21-13-9-18(10-14-21)17-5-3-2-4-6-17/h7-17,22,26H,2-6H2,1H3 |
| InChIKey | GMXPUFKGWSVSQB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |