C19H19BrFN3O3S — CID 24541192
5-bromo-2-ethoxy-N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide (PubChem CID 24541192) has the molecular formula C19H19BrFN3O3S and a molecular weight of 468.35 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxy-N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24541192 |
| Molecular Formula | C19H19BrFN3O3S |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]benzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NC(c1ccccc1F)c1nccn1C |
| InChI | InChI=1S/C19H19BrFN3O3S/c1-3-27-16-9-8-13(20)12-17(16)28(25,26)23-18(19-22-10-11-24(19)2)14-6-4-5-7-15(14)21/h4-12,18,23H,3H2,1-2H3 |
| InChIKey | IDUVVOLRCHNFOM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |