C13H20BrNO4S — CID 115755202
5-bromo-2-ethoxy-N-(1-hydroxypentan-3-yl)benzenesulfonamide (PubChem CID 115755202) has the molecular formula C13H20BrNO4S and a molecular weight of 366.28 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-(1-hydroxypentan-3-yl)benzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxy-N-(1-hydroxypentan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115755202 |
| Molecular Formula | C13H20BrNO4S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 5-bromo-2-ethoxy-N-(1-hydroxypentan-3-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NC(CC)CCO |
| InChI | InChI=1S/C13H20BrNO4S/c1-3-11(7-8-16)15-20(17,18)13-9-10(14)5-6-12(13)19-4-2/h5-6,9,11,15-16H,3-4,7-8H2,1-2H3 |
| InChIKey | NVSAFUPOLVJFJZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |