C8H10BrClO4S — CID 174820450
5-bromo-2-ethoxybenzenesulfonic acid;hydrochloride (PubChem CID 174820450) has the molecular formula C8H10BrClO4S and a molecular weight of 317.59 g/mol. Its IUPAC name is 5-bromo-2-ethoxybenzenesulfonic acid;hydrochloride.
| Compound Name | 5-bromo-2-ethoxybenzenesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174820450 |
| Molecular Formula | C8H10BrClO4S |
| Molecular Weight | 317.59 g/mol |
| Exact Mass | 315.92 |
| IUPAC Name | 5-bromo-2-ethoxybenzenesulfonic acid;hydrochloride |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)O.Cl |
| InChI | InChI=1S/C8H9BrO4S.ClH/c1-2-13-7-4-3-6(9)5-8(7)14(10,11)12;/h3-5H,2H2,1H3,(H,10,11,12);1H |
| InChIKey | LPJDCGGZEORONA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|