C12H19BrN2O3S — CID 2561925
5-bromo-N-[2-(dimethylamino)ethyl]-2-ethoxybenzenesulfonamide (PubChem CID 2561925) has the molecular formula C12H19BrN2O3S and a molecular weight of 351.27 g/mol. Its IUPAC name is 5-bromo-N-[2-(dimethylamino)ethyl]-2-ethoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-[2-(dimethylamino)ethyl]-2-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 2561925 |
| Molecular Formula | C12H19BrN2O3S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 5-bromo-N-[2-(dimethylamino)ethyl]-2-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NCCN(C)C |
| InChI | InChI=1S/C12H19BrN2O3S/c1-4-18-11-6-5-10(13)9-12(11)19(16,17)14-7-8-15(2)3/h5-6,9,14H,4,7-8H2,1-3H3 |
| InChIKey | YXJITQVFEYTKOF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |