C16H18BrNO3S — CID 8014730
5-bromo-N-(2,5-dimethylphenyl)-2-ethoxybenzenesulfonamide (PubChem CID 8014730) has the molecular formula C16H18BrNO3S and a molecular weight of 384.30 g/mol. Its IUPAC name is 5-bromo-N-(2,5-dimethylphenyl)-2-ethoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-(2,5-dimethylphenyl)-2-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 8014730 |
| Molecular Formula | C16H18BrNO3S |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 5-bromo-N-(2,5-dimethylphenyl)-2-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C16H18BrNO3S/c1-4-21-15-8-7-13(17)10-16(15)22(19,20)18-14-9-11(2)5-6-12(14)3/h5-10,18H,4H2,1-3H3 |
| InChIKey | CVZPAYGDRPMLAK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |