C14H12BrF2NO3S — CID 2488065
5-bromo-N-(2,4-difluorophenyl)-2-ethoxybenzenesulfonamide (PubChem CID 2488065) has the molecular formula C14H12BrF2NO3S and a molecular weight of 392.22 g/mol. Its IUPAC name is 5-bromo-N-(2,4-difluorophenyl)-2-ethoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-(2,4-difluorophenyl)-2-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 2488065 |
| Molecular Formula | C14H12BrF2NO3S |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 5-bromo-N-(2,4-difluorophenyl)-2-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H12BrF2NO3S/c1-2-21-13-6-3-9(15)7-14(13)22(19,20)18-12-5-4-10(16)8-11(12)17/h3-8,18H,2H2,1H3 |
| InChIKey | IHZPGBOCLWSHIA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |