C12H19BrN2O2S — CID 8513346
5-bromo-N-[3-(dimethylamino)propyl]-2-methylbenzenesulfonamide (PubChem CID 8513346) has the molecular formula C12H19BrN2O2S and a molecular weight of 335.27 g/mol. Its IUPAC name is 5-bromo-N-[3-(dimethylamino)propyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-bromo-N-[3-(dimethylamino)propyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 8513346 |
| Molecular Formula | C12H19BrN2O2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 5-bromo-N-[3-(dimethylamino)propyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)NCCCN(C)C |
| InChI | InChI=1S/C12H19BrN2O2S/c1-10-5-6-11(13)9-12(10)18(16,17)14-7-4-8-15(2)3/h5-6,9,14H,4,7-8H2,1-3H3 |
| InChIKey | KHQJGRMBXGUOOI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|