C16H16BrNO5S — CID 1294409
N-(1,3-benzodioxol-5-ylmethyl)-5-bromo-2-ethoxybenzenesulfonamide (PubChem CID 1294409) has the molecular formula C16H16BrNO5S and a molecular weight of 414.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-bromo-2-ethoxybenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-bromo-2-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 1294409 |
| Molecular Formula | C16H16BrNO5S |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-bromo-2-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H16BrNO5S/c1-2-21-14-6-4-12(17)8-16(14)24(19,20)18-9-11-3-5-13-15(7-11)23-10-22-13/h3-8,18H,2,9-10H2,1H3 |
| InChIKey | HWMLWOJHAZPJOU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |