C16H15NO7S — CID 45413467
3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-4-methoxybenzoic acid (PubChem CID 45413467) has the molecular formula C16H15NO7S and a molecular weight of 365.36 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-4-methoxybenzoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 45413467 |
| Molecular Formula | C16H15NO7S |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15NO7S/c1-22-13-5-3-11(16(18)19)7-15(13)25(20,21)17-8-10-2-4-12-14(6-10)24-9-23-12/h2-7,17H,8-9H2,1H3,(H,18,19) |
| InChIKey | NFNRVJQKGHGFTQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |