C20H24N2O7S — CID 24543766
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-methoxy-3-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 24543766) has the molecular formula C20H24N2O7S and a molecular weight of 436.49 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-methoxy-3-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-methoxy-3-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24543766 |
| Molecular Formula | C20H24N2O7S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-4-methoxy-3-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)NCc2ccc3c(c2)OCCO3)ccc1OC |
| InChI | InChI=1S/C20H24N2O7S/c1-26-8-7-22-30(24,25)19-12-15(4-6-17(19)27-2)20(23)21-13-14-3-5-16-18(11-14)29-10-9-28-16/h3-6,11-12,22H,7-10,13H2,1-2H3,(H,21,23) |
| InChIKey | PUIYKHOCRJOECA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|