C20H21N3O7S — CID 55455159
N-cyclopropyl-5-[(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)carbamoyl]-2-methoxybenzenesulfonamide (PubChem CID 55455159) has the molecular formula C20H21N3O7S and a molecular weight of 447.47 g/mol. Its IUPAC name is N-cyclopropyl-5-[(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)carbamoyl]-2-methoxybenzenesulfonamide.
| Compound Name | N-cyclopropyl-5-[(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)carbamoyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 55455159 |
| Molecular Formula | C20H21N3O7S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-cyclopropyl-5-[(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)carbamoyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccc3c(c2)OCCO3)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C20H21N3O7S/c1-28-16-7-3-13(11-18(16)31(26,27)23-14-4-5-14)20(25)22-21-19(24)12-2-6-15-17(10-12)30-9-8-29-15/h2-3,6-7,10-11,14,23H,4-5,8-9H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | PMYUFXAYZDELDV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|