C19H20N2O7 — CID 2476387
N'-(3,4,5-trimethoxybenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 2476387) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is N'-(3,4,5-trimethoxybenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N'-(3,4,5-trimethoxybenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 2476387 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N'-(3,4,5-trimethoxybenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccc3c(c2)OCCO3)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N2O7/c1-24-15-9-12(10-16(25-2)17(15)26-3)19(23)21-20-18(22)11-4-5-13-14(8-11)28-7-6-27-13/h4-5,8-10H,6-7H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | XOPMZFDQTCWRFC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|