C19H19N3O9 — CID 55454886
N'-(3,4,5-trimethoxy-2-nitrobenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 55454886) has the molecular formula C19H19N3O9 and a molecular weight of 433.37 g/mol. Its IUPAC name is N'-(3,4,5-trimethoxy-2-nitrobenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N'-(3,4,5-trimethoxy-2-nitrobenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 55454886 |
| Molecular Formula | C19H19N3O9 |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N'-(3,4,5-trimethoxy-2-nitrobenzoyl)-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccc3c(c2)OCCO3)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C19H19N3O9/c1-27-14-9-11(15(22(25)26)17(29-3)16(14)28-2)19(24)21-20-18(23)10-4-5-12-13(8-10)31-7-6-30-12/h4-5,8-9H,6-7H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | KBKKJAPFVQBOIM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 147.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|