C22H27N3O9 — CID 24514989
N'-(4-butoxy-3-methoxybenzoyl)-3,4,5-trimethoxy-2-nitrobenzohydrazide (PubChem CID 24514989) has the molecular formula C22H27N3O9 and a molecular weight of 477.47 g/mol. Its IUPAC name is N'-(4-butoxy-3-methoxybenzoyl)-3,4,5-trimethoxy-2-nitrobenzohydrazide.
| Compound Name | N'-(4-butoxy-3-methoxybenzoyl)-3,4,5-trimethoxy-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 24514989 |
| Molecular Formula | C22H27N3O9 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N'-(4-butoxy-3-methoxybenzoyl)-3,4,5-trimethoxy-2-nitrobenzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)c2cc(OC)c(OC)c(OC)c2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C22H27N3O9/c1-6-7-10-34-15-9-8-13(11-16(15)30-2)21(26)23-24-22(27)14-12-17(31-3)19(32-4)20(33-5)18(14)25(28)29/h8-9,11-12H,6-7,10H2,1-5H3,(H,23,26)(H,24,27) |
| InChIKey | MHSHPBKJYMFZJZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 147.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|