C24H32N2O7 — CID 30317919
4-butoxy-3-methoxy-N'-[3-(3,4,5-trimethoxyphenyl)propanoyl]benzohydrazide (PubChem CID 30317919) has the molecular formula C24H32N2O7 and a molecular weight of 460.53 g/mol. Its IUPAC name is 4-butoxy-3-methoxy-N'-[3-(3,4,5-trimethoxyphenyl)propanoyl]benzohydrazide.
| Compound Name | 4-butoxy-3-methoxy-N'-[3-(3,4,5-trimethoxyphenyl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 30317919 |
| Molecular Formula | C24H32N2O7 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 4-butoxy-3-methoxy-N'-[3-(3,4,5-trimethoxyphenyl)propanoyl]benzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)CCc2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H32N2O7/c1-6-7-12-33-18-10-9-17(15-19(18)29-2)24(28)26-25-22(27)11-8-16-13-20(30-3)23(32-5)21(14-16)31-4/h9-10,13-15H,6-8,11-12H2,1-5H3,(H,25,27)(H,26,28) |
| InChIKey | XJEOQRBPYBDWLK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|