C26H30N2O6 — CID 24531696
4-butoxy-N'-[3-(4,7-dimethyl-2-oxochromen-3-yl)propanoyl]-3-methoxybenzohydrazide (PubChem CID 24531696) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is 4-butoxy-N'-[3-(4,7-dimethyl-2-oxochromen-3-yl)propanoyl]-3-methoxybenzohydrazide.
| Compound Name | 4-butoxy-N'-[3-(4,7-dimethyl-2-oxochromen-3-yl)propanoyl]-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 24531696 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 4-butoxy-N'-[3-(4,7-dimethyl-2-oxochromen-3-yl)propanoyl]-3-methoxybenzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)CCc2c(C)c3ccc(C)cc3oc2=O)cc1OC |
| InChI | InChI=1S/C26H30N2O6/c1-5-6-13-33-21-11-8-18(15-23(21)32-4)25(30)28-27-24(29)12-10-20-17(3)19-9-7-16(2)14-22(19)34-26(20)31/h7-9,11,14-15H,5-6,10,12-13H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | LURKBEXBYLRPMA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|