C24H30N2O6 — CID 35781657
N'-[4-(4-acetylphenoxy)butanoyl]-4-butoxy-3-methoxybenzohydrazide (PubChem CID 35781657) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is N'-[4-(4-acetylphenoxy)butanoyl]-4-butoxy-3-methoxybenzohydrazide.
| Compound Name | N'-[4-(4-acetylphenoxy)butanoyl]-4-butoxy-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 35781657 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N'-[4-(4-acetylphenoxy)butanoyl]-4-butoxy-3-methoxybenzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)CCCOc2ccc(C(C)=O)cc2)cc1OC |
| InChI | InChI=1S/C24H30N2O6/c1-4-5-14-32-21-13-10-19(16-22(21)30-3)24(29)26-25-23(28)7-6-15-31-20-11-8-18(9-12-20)17(2)27/h8-13,16H,4-7,14-15H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | LIJGACWMMGRAPO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|