C18H22N2O4 — CID 18145814
3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[2-(ethylamino)-2-oxoethyl]propanamide (PubChem CID 18145814) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[2-(ethylamino)-2-oxoethyl]propanamide.
| Compound Name | 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[2-(ethylamino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 18145814 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[2-(ethylamino)-2-oxoethyl]propanamide |
| SMILES | CCNC(=O)CNC(=O)CCc1c(C)c2ccc(C)cc2oc1=O |
| InChI | InChI=1S/C18H22N2O4/c1-4-19-17(22)10-20-16(21)8-7-14-12(3)13-6-5-11(2)9-15(13)24-18(14)23/h5-6,9H,4,7-8,10H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | KFMAYGKGUSEQBK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|