C21H24N2O3S — CID 24524767
N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide (PubChem CID 24524767) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 24524767 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3-(4,7-dimethyl-2-oxochromen-3-yl)propanamide |
| SMILES | Cc1ccc2c(C)c(CCC(=O)Nc3nc(C(C)(C)C)cs3)c(=O)oc2c1 |
| InChI | InChI=1S/C21H24N2O3S/c1-12-6-7-14-13(2)15(19(25)26-16(14)10-12)8-9-18(24)23-20-22-17(11-27-20)21(3,4)5/h6-7,10-11H,8-9H2,1-5H3,(H,22,23,24) |
| InChIKey | NPOGUUOBWFKKAE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|