C11H16N2O3S — CID 6465782
4-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid (PubChem CID 6465782) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6465782 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)c1csc(NC(=O)CCC(=O)O)n1 |
| InChI | InChI=1S/C11H16N2O3S/c1-11(2,3)7-6-17-10(12-7)13-8(14)4-5-9(15)16/h6H,4-5H2,1-3H3,(H,15,16)(H,12,13,14) |
| InChIKey | LTEGOGTWQQWAHO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |