C17H22N2OS — CID 1223668
N-(4-tert-butyl-1,3-thiazol-2-yl)-4-phenylbutanamide (PubChem CID 1223668) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-4-phenylbutanamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-4-phenylbutanamide |
|---|---|
| PubChem CID | 1223668 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-4-phenylbutanamide |
| SMILES | CC(C)(C)c1csc(NC(=O)CCCc2ccccc2)n1 |
| InChI | InChI=1S/C17H22N2OS/c1-17(2,3)14-12-21-16(18-14)19-15(20)11-7-10-13-8-5-4-6-9-13/h4-6,8-9,12H,7,10-11H2,1-3H3,(H,18,19,20) |
| InChIKey | MQWKEJCDGOMPIQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |