C16H20N2OS2 — CID 107025368
N-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenyl-2-sulfanylpropanamide (PubChem CID 107025368) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenyl-2-sulfanylpropanamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenyl-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107025368 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenyl-2-sulfanylpropanamide |
| SMILES | CC(C)(C)c1csc(NC(=O)C(S)Cc2ccccc2)n1 |
| InChI | InChI=1S/C16H20N2OS2/c1-16(2,3)13-10-21-15(17-13)18-14(19)12(20)9-11-7-5-4-6-8-11/h4-8,10,12,20H,9H2,1-3H3,(H,17,18,19) |
| InChIKey | HGJPRQQFSHVIGP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|