C21H24F3NO3 — CID 24621480
3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]propanamide (PubChem CID 24621480) has the molecular formula C21H24F3NO3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]propanamide.
| Compound Name | 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 24621480 |
| Molecular Formula | C21H24F3NO3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]propanamide |
| SMILES | Cc1ccc2c(C)c(CCC(=O)NC3CCCC(C(F)(F)F)C3)c(=O)oc2c1 |
| InChI | InChI=1S/C21H24F3NO3/c1-12-6-7-16-13(2)17(20(27)28-18(16)10-12)8-9-19(26)25-15-5-3-4-14(11-15)21(22,23)24/h6-7,10,14-15H,3-5,8-9,11H2,1-2H3,(H,25,26) |
| InChIKey | IWHHMZMSTWCFNX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|