C22H24N2O3 — CID 51940941
4,7-dimethyl-3-[3-oxo-3-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]propyl]chromen-2-one (PubChem CID 51940941) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4,7-dimethyl-3-[3-oxo-3-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]propyl]chromen-2-one.
| Compound Name | 4,7-dimethyl-3-[3-oxo-3-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]propyl]chromen-2-one |
|---|---|
| PubChem CID | 51940941 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4,7-dimethyl-3-[3-oxo-3-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]propyl]chromen-2-one |
| SMILES | Cc1ccc2c(C)c(CCC(=O)N3CCC[C@@H]3c3ccc[nH]3)c(=O)oc2c1 |
| InChI | InChI=1S/C22H24N2O3/c1-14-7-8-16-15(2)17(22(26)27-20(16)13-14)9-10-21(25)24-12-4-6-19(24)18-5-3-11-23-18/h3,5,7-8,11,13,19,23H,4,6,9-10,12H2,1-2H3/t19-/m1/s1 |
| InChIKey | VQJWEUBJVBMRPZ-LJQANCHMSA-N |
| XLogP | 4.03 |
| TPSA | 66.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|