C20H23NO6 — CID 40653207
(2R)-1-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyl]piperidine-2-carboxylic acid (PubChem CID 40653207) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is (2R)-1-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyl]piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 40653207 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (2R)-1-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyl]piperidine-2-carboxylic acid |
| SMILES | COc1ccc2c(C)c(CCC(=O)N3CCCC[C@@H]3C(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C20H23NO6/c1-12-14-7-6-13(26-2)11-17(14)27-20(25)15(12)8-9-18(22)21-10-4-3-5-16(21)19(23)24/h6-7,11,16H,3-5,8-10H2,1-2H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | TYUFSXIBMQOPIZ-MRXNPFEDSA-N |
| XLogP | 2.51 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|