C22H23NO6 — CID 3840295
1-[3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoyl]piperidine-2-carboxylic acid (PubChem CID 3840295) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3840295 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 1-[3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoyl]piperidine-2-carboxylic acid |
| SMILES | Cc1coc2cc3oc(=O)c(CCC(=O)N4CCCCC4C(=O)O)c(C)c3cc12 |
| InChI | InChI=1S/C22H23NO6/c1-12-11-28-18-10-19-16(9-15(12)18)13(2)14(22(27)29-19)6-7-20(24)23-8-4-3-5-17(23)21(25)26/h9-11,17H,3-8H2,1-2H3,(H,25,26) |
| InChIKey | VVMIWWGCVXTKNX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|