C20H23NO4 — CID 3603489
N-butan-2-yl-3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide (PubChem CID 3603489) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-butan-2-yl-3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide.
| Compound Name | N-butan-2-yl-3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide |
|---|---|
| PubChem CID | 3603489 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-butan-2-yl-3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide |
| SMILES | CCC(C)NC(=O)CCc1c(C)c2cc3c(C)coc3cc2oc1=O |
| InChI | InChI=1S/C20H23NO4/c1-5-12(3)21-19(22)7-6-14-13(4)16-8-15-11(2)10-24-17(15)9-18(16)25-20(14)23/h8-10,12H,5-7H2,1-4H3,(H,21,22) |
| InChIKey | ASXWUIINODHLRO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|