C27H24N2O7 — CID 4836753
2-[3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid (PubChem CID 4836753) has the molecular formula C27H24N2O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is 2-[3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 4836753 |
| Molecular Formula | C27H24N2O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-[3-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
| SMILES | Cc1coc2cc3oc(=O)c(CCC(=O)NC(Cc4c[nH]c5ccc(O)cc45)C(=O)O)c(C)c3cc12 |
| InChI | InChI=1S/C27H24N2O7/c1-13-12-35-23-10-24-19(9-18(13)23)14(2)17(27(34)36-24)4-6-25(31)29-22(26(32)33)7-15-11-28-21-5-3-16(30)8-20(15)21/h3,5,8-12,22,28,30H,4,6-7H2,1-2H3,(H,29,31)(H,32,33) |
| InChIKey | GJFXGPUGMSZGLM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|