C24H21ClN2O7 — CID 4834312
2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid (PubChem CID 4834312) has the molecular formula C24H21ClN2O7 and a molecular weight of 484.89 g/mol. Its IUPAC name is 2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 4834312 |
| Molecular Formula | C24H21ClN2O7 |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
| SMILES | COc1cc2oc(=O)c(CC(=O)NC(Cc3c[nH]c4ccc(O)cc34)C(=O)O)c(C)c2cc1Cl |
| InChI | InChI=1S/C24H21ClN2O7/c1-11-14-7-17(25)21(33-2)9-20(14)34-24(32)15(11)8-22(29)27-19(23(30)31)5-12-10-26-18-4-3-13(28)6-16(12)18/h3-4,6-7,9-10,19,26,28H,5,8H2,1-2H3,(H,27,29)(H,30,31) |
| InChIKey | SESXRBGAGSCTCI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|