C22H21NO8 — CID 3819030
2-[[2-(6,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-2-(4-hydroxyphenyl)acetic acid (PubChem CID 3819030) has the molecular formula C22H21NO8 and a molecular weight of 427.41 g/mol. Its IUPAC name is 2-[[2-(6,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-2-(4-hydroxyphenyl)acetic acid.
| Compound Name | 2-[[2-(6,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-2-(4-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 3819030 |
| Molecular Formula | C22H21NO8 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-[[2-(6,7-dimethoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-2-(4-hydroxyphenyl)acetic acid |
| SMILES | COc1cc2oc(=O)c(CC(=O)NC(C(=O)O)c3ccc(O)cc3)c(C)c2cc1OC |
| InChI | InChI=1S/C22H21NO8/c1-11-14-8-17(29-2)18(30-3)10-16(14)31-22(28)15(11)9-19(25)23-20(21(26)27)12-4-6-13(24)7-5-12/h4-8,10,20,24H,9H2,1-3H3,(H,23,25)(H,26,27) |
| InChIKey | DGQAISFFFPORKV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|