C22H19Cl2NO6 — CID 3789070
2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-(4-chlorophenyl)propanoic acid (PubChem CID 3789070) has the molecular formula C22H19Cl2NO6 and a molecular weight of 464.30 g/mol. Its IUPAC name is 2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-(4-chlorophenyl)propanoic acid.
| Compound Name | 2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-(4-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 3789070 |
| Molecular Formula | C22H19Cl2NO6 |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]-3-(4-chlorophenyl)propanoic acid |
| SMILES | COc1cc2oc(=O)c(CC(=O)NC(Cc3ccc(Cl)cc3)C(=O)O)c(C)c2cc1Cl |
| InChI | InChI=1S/C22H19Cl2NO6/c1-11-14-8-16(24)19(30-2)10-18(14)31-22(29)15(11)9-20(26)25-17(21(27)28)7-12-3-5-13(23)6-4-12/h3-6,8,10,17H,7,9H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | IIIXZBYLPTUVOB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|