C18H16ClNO5 — CID 4914066
2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(furan-2-ylmethyl)acetamide (PubChem CID 4914066) has the molecular formula C18H16ClNO5 and a molecular weight of 361.78 g/mol. Its IUPAC name is 2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4914066 |
| Molecular Formula | C18H16ClNO5 |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(furan-2-ylmethyl)acetamide |
| SMILES | COc1cc2oc(=O)c(CC(=O)NCc3ccco3)c(C)c2cc1Cl |
| InChI | InChI=1S/C18H16ClNO5/c1-10-12-6-14(19)16(23-2)8-15(12)25-18(22)13(10)7-17(21)20-9-11-4-3-5-24-11/h3-6,8H,7,9H2,1-2H3,(H,20,21) |
| InChIKey | PMTBDQNRZVPURI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|