C18H24ClN2O4+ — CID 7599624
3-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]propyl-dimethylazanium (PubChem CID 7599624) has the molecular formula C18H24ClN2O4+ and a molecular weight of 367.85 g/mol. Its IUPAC name is 3-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7599624 |
| Molecular Formula | C18H24ClN2O4+ |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 3-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]propyl-dimethylazanium |
| SMILES | COc1cc2oc(=O)c(CC(=O)NCCC[NH+](C)C)c(C)c2cc1Cl |
| InChI | InChI=1S/C18H23ClN2O4/c1-11-12-8-14(19)16(24-4)10-15(12)25-18(23)13(11)9-17(22)20-6-5-7-21(2)3/h8,10H,5-7,9H2,1-4H3,(H,20,22)/p+1 |
| InChIKey | JNHHHFYWMDGHBG-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|