C19H22ClN3O7 — CID 3741271
5-(carbamoylamino)-2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]pentanoic acid (PubChem CID 3741271) has the molecular formula C19H22ClN3O7 and a molecular weight of 439.85 g/mol. Its IUPAC name is 5-(carbamoylamino)-2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]pentanoic acid.
| Compound Name | 5-(carbamoylamino)-2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 3741271 |
| Molecular Formula | C19H22ClN3O7 |
| Molecular Weight | 439.85 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 5-(carbamoylamino)-2-[[2-(6-chloro-7-methoxy-4-methyl-2-oxochromen-3-yl)acetyl]amino]pentanoic acid |
| SMILES | COc1cc2oc(=O)c(CC(=O)NC(CCCNC(N)=O)C(=O)O)c(C)c2cc1Cl |
| InChI | InChI=1S/C19H22ClN3O7/c1-9-10-6-12(20)15(29-2)8-14(10)30-18(27)11(9)7-16(24)23-13(17(25)26)4-3-5-22-19(21)28/h6,8,13H,3-5,7H2,1-2H3,(H,23,24)(H,25,26)(H3,21,22,28) |
| InChIKey | XBTNFUDZOFMOMP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.85 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|