C28H29N3O7 — CID 3716419
5-(carbamoylamino)-2-[3-(2,5-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]pentanoic acid (PubChem CID 3716419) has the molecular formula C28H29N3O7 and a molecular weight of 519.55 g/mol. Its IUPAC name is 5-(carbamoylamino)-2-[3-(2,5-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]pentanoic acid.
| Compound Name | 5-(carbamoylamino)-2-[3-(2,5-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 3716419 |
| Molecular Formula | C28H29N3O7 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 5-(carbamoylamino)-2-[3-(2,5-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]pentanoic acid |
| SMILES | Cc1oc2cc3oc(=O)c(CCC(=O)NC(CCCNC(N)=O)C(=O)O)c(C)c3cc2c1-c1ccccc1 |
| InChI | InChI=1S/C28H29N3O7/c1-15-18(10-11-24(32)31-21(26(33)34)9-6-12-30-28(29)36)27(35)38-22-14-23-20(13-19(15)22)25(16(2)37-23)17-7-4-3-5-8-17/h3-5,7-8,13-14,21H,6,9-12H2,1-2H3,(H,31,32)(H,33,34)(H3,29,30,36) |
| InChIKey | FCAKWBWRDKWMAT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 164.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|