C28H29NO6 — CID 3559385
3-methyl-2-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]butanoic acid (PubChem CID 3559385) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is 3-methyl-2-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]butanoic acid.
| Compound Name | 3-methyl-2-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 3559385 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 3-methyl-2-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]butanoic acid |
| SMILES | Cc1oc2c(C)c3oc(=O)c(CCC(=O)NC(C(=O)O)C(C)C)c(C)c3cc2c1-c1ccccc1 |
| InChI | InChI=1S/C28H29NO6/c1-14(2)24(27(31)32)29-22(30)12-11-19-15(3)20-13-21-23(18-9-7-6-8-10-18)17(5)34-26(21)16(4)25(20)35-28(19)33/h6-10,13-14,24H,11-12H2,1-5H3,(H,29,30)(H,31,32) |
| InChIKey | UEKWCTOVBKYTRC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|