C27H27NO6 — CID 3800092
2-[3-(5,9-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]-3-methylbutanoic acid (PubChem CID 3800092) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is 2-[3-(5,9-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]-3-methylbutanoic acid.
| Compound Name | 2-[3-(5,9-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 3800092 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-[3-(5,9-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoylamino]-3-methylbutanoic acid |
| SMILES | Cc1c(CCC(=O)NC(C(=O)O)C(C)C)c(=O)oc2c(C)c3occ(-c4ccccc4)c3cc12 |
| InChI | InChI=1S/C27H27NO6/c1-14(2)23(26(30)31)28-22(29)11-10-18-15(3)19-12-20-21(17-8-6-5-7-9-17)13-33-24(20)16(4)25(19)34-27(18)32/h5-9,12-14,23H,10-11H2,1-4H3,(H,28,29)(H,30,31) |
| InChIKey | WMZGXKQYDVSFGT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|