C23H27NO6 — CID 3276801
4-methyl-2-[3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]pentanoic acid (PubChem CID 3276801) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is 4-methyl-2-[3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]pentanoic acid.
| Compound Name | 4-methyl-2-[3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 3276801 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 4-methyl-2-[3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanoylamino]pentanoic acid |
| SMILES | Cc1coc2c(C)c3oc(=O)c(CCC(=O)NC(CC(C)C)C(=O)O)c(C)c3cc12 |
| InChI | InChI=1S/C23H27NO6/c1-11(2)8-18(22(26)27)24-19(25)7-6-15-13(4)17-9-16-12(3)10-29-20(16)14(5)21(17)30-23(15)28/h9-11,18H,6-8H2,1-5H3,(H,24,25)(H,26,27) |
| InChIKey | HOOLKKGFRFYWHA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|