C25H29NO6 — CID 3832640
2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]-4-methylpentanoic acid (PubChem CID 3832640) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 3832640 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-[[2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetyl]amino]-4-methylpentanoic acid |
| SMILES | Cc1c(CC(=O)NC(CC(C)C)C(=O)O)c(=O)oc2c(C)c3oc4c(c3cc12)CCCC4 |
| InChI | InChI=1S/C25H29NO6/c1-12(2)9-19(24(28)29)26-21(27)11-17-13(3)16-10-18-15-7-5-6-8-20(15)31-23(18)14(4)22(16)32-25(17)30/h10,12,19H,5-9,11H2,1-4H3,(H,26,27)(H,28,29) |
| InChIKey | DMTLUCXYIKQEPL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|