C26H22F3NO4 — CID 71584254
2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 71584254) has the molecular formula C26H22F3NO4 and a molecular weight of 469.46 g/mol. Its IUPAC name is 2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 71584254 |
| Molecular Formula | C26H22F3NO4 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 2-(4,11-dimethyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1c(CC(=O)Nc2cccc(C(F)(F)F)c2)c(=O)oc2c(C)c3oc4c(c3cc12)CCCC4 |
| InChI | InChI=1S/C26H22F3NO4/c1-13-18-11-20-17-8-3-4-9-21(17)33-24(20)14(2)23(18)34-25(32)19(13)12-22(31)30-16-7-5-6-15(10-16)26(27,28)29/h5-7,10-11H,3-4,8-9,12H2,1-2H3,(H,30,31) |
| InChIKey | OSYCHPKSHHSDPQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|